Worked example where both the acid and the conjugate base are major species

Ka =[CH3CH2CO2][H3O+]
[CH3CH2CO2H]
A solution of 0.100
CH3CH2CO2H and 0.100
CH3CH2CO2Na
has a pH of 4.89. Use these data to calculate Ka(CH3CH2CO2H).
 
[H3O+] = 10–4.89
 
[H3O+] = 1.29 ×10–5
Calculate [H3O+]:
 
 
CH3CH2CO2(aq) + H2O CH3CH2CO2H(aq) + OH
CH3CH2CO2H(aq) + H2O CH3CH2CO2(aq) + H3O+
Enter the second product of the reaction of each species to reach equilibrium.
 
 
 [CH3CH2CO2][CH3CH2CO2H][H3O+]
initial

(before reaction)
0.1000.1001.29 ×10–5
change

(due to reaction)
Both members of a conjugate pair are consumed
in one reaction to reach equilibrium and produced
in the other.Their change in concentration is smaller
than if only one member of the conjugate pair is dissolved.
 
equilibrium
0.1000.1001.29 ×10–5
Enter the initial concentrations and the calculated [H3O+].
Deduce the other equilibrium concentrations.
 
 
Ka =0.100
 × 1.29 ×10–5
0.100
Ka = 1.3 × 10–5
Substitute the equilibrium concentrations:
 
Note that Ka equals [H3O+] for systems having the same concentration for both members of the conjugate pair.