THER Enth (Bond) - Contents
- Page 1Introduction - ReviewDescribes how average bond enthalpies can be used to estimate the overall enthalpy change for a reaction
- 14 marksPage 2ProblemUse bond enthalpies to estimate ΔrH for the reaction:
H2C=CH2(g) + H2(g) → H3C–CH3(g) - 14 marksPage 3ProblemUse average bond enthalpies to estimate ΔrH for the reaction:
CH3CH2CH2CH2CH2CH2CH2CH3(g)
CH3CH2CH2CH3(g) + CH3CH2CH=CH2(g)